C27H35NO3S — CID 150876990
butyl 3-[6-[(2-methylphenyl)methylsulfanyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate (PubChem CID 150876990) has the molecular formula C27H35NO3S and a molecular weight of 453.65 g/mol. Its IUPAC name is butyl 3-[6-[(2-methylphenyl)methylsulfanyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate.
| Compound Name | butyl 3-[6-[(2-methylphenyl)methylsulfanyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
|---|---|
| PubChem CID | 150876990 |
| Molecular Formula | C27H35NO3S |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | butyl 3-[6-[(2-methylphenyl)methylsulfanyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
| SMILES | CCCCOC(=O)CCN1CCC2(CC1)COc1cc(SCc3ccccc3C)ccc12 |
| InChI | InChI=1S/C27H35NO3S/c1-3-4-17-30-26(29)11-14-28-15-12-27(13-16-28)20-31-25-18-23(9-10-24(25)27)32-19-22-8-6-5-7-21(22)2/h5-10,18H,3-4,11-17,19-20H2,1-2H3 |
| InChIKey | KVEXFYMCHKVBEH-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|