C17H15ClN2O2 — CID 150602716
1-(4-chlorophenyl)-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one (PubChem CID 150602716) has the molecular formula C17H15ClN2O2 and a molecular weight of 314.77 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one.
| Compound Name | 1-(4-chlorophenyl)-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 150602716 |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2-hydroxypropyl)-1,8-naphthyridin-2-one |
| SMILES | CC(O)Cc1cc2cccnc2n(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C17H15ClN2O2/c1-11(21)9-13-10-12-3-2-8-19-16(12)20(17(13)22)15-6-4-14(18)5-7-15/h2-8,10-11,21H,9H2,1H3 |
| InChIKey | ISFHRJBPDITSLO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |