C20H20N4O2 — CID 150605771
tert-butyl 3-[2-(3-cyanophenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate (PubChem CID 150605771) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is tert-butyl 3-[2-(3-cyanophenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate.
| Compound Name | tert-butyl 3-[2-(3-cyanophenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate |
|---|---|
| PubChem CID | 150605771 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | tert-butyl 3-[2-(3-cyanophenyl)ethynyl]-6,8-dihydro-5H-imidazo[1,5-a]pyrazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCn2c(cnc2C#Cc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C20H20N4O2/c1-20(2,3)26-19(25)23-9-10-24-17(14-23)13-22-18(24)8-7-15-5-4-6-16(11-15)12-21/h4-6,11,13H,9-10,14H2,1-3H3 |
| InChIKey | ISVNVNIXFRMURE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|