C23H17ClF3N3O — CID 150606383
5-(4-chlorophenyl)-4-(2-deuteriophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-dihydropyrazole-2-carboxamide (PubChem CID 150606383) has the molecular formula C23H17ClF3N3O and a molecular weight of 444.86 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-(2-deuteriophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-dihydropyrazole-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-4-(2-deuteriophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 150606383 |
| Molecular Formula | C23H17ClF3N3O |
| Molecular Weight | 444.86 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 5-(4-chlorophenyl)-4-(2-deuteriophenyl)-N-[3-(trifluoromethyl)phenyl]-1,3-dihydropyrazole-2-carboxamide |
| SMILES | [2H]c1ccccc1C1=C(c2ccc(Cl)cc2)NN(C(=O)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C23H17ClF3N3O/c24-18-11-9-16(10-12-18)21-20(15-5-2-1-3-6-15)14-30(29-21)22(31)28-19-8-4-7-17(13-19)23(25,26)27/h1-13,29H,14H2,(H,28,31)/i5D |
| InChIKey | ISYRMZLYBMVPHU-UICOGKGYSA-N |
| XLogP | 6.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.86 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|