C25H28N2O4 — CID 150619709
pyridin-3-yl N-[2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]propan-2-yl]carbamate (PubChem CID 150619709) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is pyridin-3-yl N-[2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]propan-2-yl]carbamate.
| Compound Name | pyridin-3-yl N-[2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 150619709 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | pyridin-3-yl N-[2-[4-[4-(3-methoxypropoxy)phenyl]phenyl]propan-2-yl]carbamate |
| SMILES | COCCCOc1ccc(-c2ccc(C(C)(C)NC(=O)Oc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C25H28N2O4/c1-25(2,27-24(28)31-23-6-4-15-26-18-23)21-11-7-19(8-12-21)20-9-13-22(14-10-20)30-17-5-16-29-3/h4,6-15,18H,5,16-17H2,1-3H3,(H,27,28) |
| InChIKey | IVQIPWDTLVVUHP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|