C14H18BrF2NO3 — CID 150622465
[1-(4-bromo-2,5-difluorophenoxy)-2,4-dimethylpentan-2-yl] carbamate (PubChem CID 150622465) has the molecular formula C14H18BrF2NO3 and a molecular weight of 366.20 g/mol. Its IUPAC name is [1-(4-bromo-2,5-difluorophenoxy)-2,4-dimethylpentan-2-yl] carbamate.
| Compound Name | [1-(4-bromo-2,5-difluorophenoxy)-2,4-dimethylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 150622465 |
| Molecular Formula | C14H18BrF2NO3 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | [1-(4-bromo-2,5-difluorophenoxy)-2,4-dimethylpentan-2-yl] carbamate |
| SMILES | CC(C)CC(C)(COc1cc(F)c(Br)cc1F)OC(N)=O |
| InChI | InChI=1S/C14H18BrF2NO3/c1-8(2)6-14(3,21-13(18)19)7-20-12-5-10(16)9(15)4-11(12)17/h4-5,8H,6-7H2,1-3H3,(H2,18,19) |
| InChIKey | IWEVARIKNJDKIE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|