C24H31BrF3N3O4SSi — CID 150624497
N-[3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-4,4,4-trifluorobutyl]-4-methylbenzenesulfonamide (PubChem CID 150624497) has the molecular formula C24H31BrF3N3O4SSi and a molecular weight of 622.58 g/mol. Its IUPAC name is N-[3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-4,4,4-trifluorobutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-4,4,4-trifluorobutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 150624497 |
| Molecular Formula | C24H31BrF3N3O4SSi |
| Molecular Weight | 622.58 g/mol |
| Exact Mass | 621.09 |
| IUPAC Name | N-[3-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxy-4,4,4-trifluorobutyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCC(Oc2nc3c(ccn3COCC[Si](C)(C)C)cc2Br)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H31BrF3N3O4SSi/c1-17-5-7-19(8-6-17)36(32,33)29-11-9-21(24(26,27)28)35-23-20(25)15-18-10-12-31(22(18)30-23)16-34-13-14-37(2,3)4/h5-8,10,12,15,21,29H,9,11,13-14,16H2,1-4H3 |
| InChIKey | IWPHDPIQNBBGDF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|