C16H15NO2 — CID 150624746
3-(6-cyanonaphthalen-2-yl)-2,2-dimethylpropanoic acid (PubChem CID 150624746) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is 3-(6-cyanonaphthalen-2-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(6-cyanonaphthalen-2-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 150624746 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 3-(6-cyanonaphthalen-2-yl)-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(Cc1ccc2cc(C#N)ccc2c1)C(=O)O |
| InChI | InChI=1S/C16H15NO2/c1-16(2,15(18)19)9-11-3-5-14-8-12(10-17)4-6-13(14)7-11/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | IWQOGEDTDIBEOJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |