C14H9F3N2O4 — CID 70060134
(6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid (PubChem CID 70060134) has the molecular formula C14H9F3N2O4 and a molecular weight of 326.23 g/mol. Its IUPAC name is (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70060134 |
| Molecular Formula | C14H9F3N2O4 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid |
| SMILES | N#Cc1ccc2cc(NC(=O)O)ccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H8N2O2.C2HF3O2/c13-7-8-1-2-10-6-11(14-12(15)16)4-3-9(10)5-8;3-2(4,5)1(6)7/h1-6,14H,(H,15,16);(H,6,7) |
| InChIKey | GRDAZZCYXJDKTK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |