(6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid

C14H9F3N2O4 — CID 70060134

IUPAC(6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid
SMILESN#Cc1ccc2cc(NC(=O)O)ccc2c1.O=C(O)C(F)(F)F
InChIInChI=1S/C12H8N2O2.C2HF3O2/c13-7-8-1-2-10-6-11(14-12(15)16)4-3-9(10)5-8;3-2(4,5)1(6)7/h1-6,14H,(H,15,16);(H,6,7)
InChIKeyGRDAZZCYXJDKTK-UHFFFAOYSA-N
MW326.23 g/mol
LogP3.43
Rot. Bonds1

About (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid

(6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid (PubChem CID 70060134) has the molecular formula C14H9F3N2O4 and a molecular weight of 326.23 g/mol. Its IUPAC name is (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name(6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid
PubChem CID70060134
Molecular FormulaC14H9F3N2O4
Molecular Weight326.23 g/mol
Exact Mass326.05
IUPAC Name(6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid
SMILESN#Cc1ccc2cc(NC(=O)O)ccc2c1.O=C(O)C(F)(F)F
InChIInChI=1S/C12H8N2O2.C2HF3O2/c13-7-8-1-2-10-6-11(14-12(15)16)4-3-9(10)5-8;3-2(4,5)1(6)7/h1-6,14H,(H,15,16);(H,6,7)
InChIKeyGRDAZZCYXJDKTK-UHFFFAOYSA-N
XLogP3.43
TPSA110.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.23
LogP ≤ 53.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid (CID 70060134) is (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid is N#Cc1ccc2cc(NC(=O)O)ccc2c1.O=C(O)C(F)(F)F.
What is the InChIKey of (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid?
The InChIKey is GRDAZZCYXJDKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2.C2HF3O2/c13-7-8-1-2-10-6-11(14-12(15)16)4-3-9(10)5-8;3-2(4,5)1(6)7/h1-6,14H,(H,15,16);(H,6,7).
What are the key properties of (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid?
(6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid has a molecular weight of 326.23 g/mol, XLogP of 3.43, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyanonaphthalen-2-yl)carbamic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 70060134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).