About 2H-isoindol-5-ylcarbamic acid
2H-isoindol-5-ylcarbamic acid (PubChem CID 91130644) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 2H-isoindol-5-ylcarbamic acid.
Molecular Properties
| Compound Name | 2H-isoindol-5-ylcarbamic acid |
| PubChem CID | 91130644 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2H-isoindol-5-ylcarbamic acid |
| SMILES | O=C(O)Nc1ccc2c[nH]cc2c1 |
| InChI | InChI=1S/C9H8N2O2/c12-9(13)11-8-2-1-6-4-10-5-7(6)3-8/h1-5,10-11H,(H,12,13) |
| InChIKey | CEDCITIOJGKYTF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2H-isoindol-5-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-isoindol-5-ylcarbamic acid?
The IUPAC name of 2H-isoindol-5-ylcarbamic acid (CID 91130644) is 2H-isoindol-5-ylcarbamic acid.
What is the SMILES notation for 2H-isoindol-5-ylcarbamic acid?
The canonical SMILES for 2H-isoindol-5-ylcarbamic acid is O=C(O)Nc1ccc2c[nH]cc2c1.
What is the InChIKey of 2H-isoindol-5-ylcarbamic acid?
The InChIKey is CEDCITIOJGKYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-9(13)11-8-2-1-6-4-10-5-7(6)3-8/h1-5,10-11H,(H,12,13).
What are the key properties of 2H-isoindol-5-ylcarbamic acid?
2H-isoindol-5-ylcarbamic acid has a molecular weight of 176.17 g/mol, XLogP of 2.26, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-isoindol-5-ylcarbamic acid is sourced from PubChem (CID 91130644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).