C13H20O8S3 — CID 150626257
4-[1-carboxy-1,2-bis(2-carboxyethylsulfanyl)ethyl]sulfanylbutanoic acid (PubChem CID 150626257) has the molecular formula C13H20O8S3 and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-[1-carboxy-1,2-bis(2-carboxyethylsulfanyl)ethyl]sulfanylbutanoic acid.
| Compound Name | 4-[1-carboxy-1,2-bis(2-carboxyethylsulfanyl)ethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 150626257 |
| Molecular Formula | C13H20O8S3 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 4-[1-carboxy-1,2-bis(2-carboxyethylsulfanyl)ethyl]sulfanylbutanoic acid |
| SMILES | O=C(O)CCCSC(CSCCC(=O)O)(SCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H20O8S3/c14-9(15)2-1-5-23-13(12(20)21,24-7-4-11(18)19)8-22-6-3-10(16)17/h1-8H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | IWYGTZIOIJXBGR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|