C22H27NO — CID 15063946
(4R,5R,8R)-N,5,8-trimethyl-9-methylidene-N-phenyltricyclo[6.3.0.01,5]undec-6-ene-4-carboxamide (PubChem CID 15063946) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is (4R,5R,8R)-N,5,8-trimethyl-9-methylidene-N-phenyltricyclo[6.3.0.01,5]undec-6-ene-4-carboxamide.
| Compound Name | (4R,5R,8R)-N,5,8-trimethyl-9-methylidene-N-phenyltricyclo[6.3.0.01,5]undec-6-ene-4-carboxamide |
|---|---|
| PubChem CID | 15063946 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (4R,5R,8R)-N,5,8-trimethyl-9-methylidene-N-phenyltricyclo[6.3.0.01,5]undec-6-ene-4-carboxamide |
| SMILES | C=C1CCC23CC[C@@H](C(=O)N(C)c4ccccc4)[C@@]2(C)C=C[C@]13C |
| InChI | InChI=1S/C22H27NO/c1-16-10-12-22-13-11-18(21(22,3)15-14-20(16,22)2)19(24)23(4)17-8-6-5-7-9-17/h5-9,14-15,18H,1,10-13H2,2-4H3/t18-,20+,21+,22?/m0/s1 |
| InChIKey | UJUWDMVBSZHPKL-JKCSXKQMSA-N |
| XLogP | 4.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|