C11H11F4NO3 — CID 150641345
methyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate (PubChem CID 150641345) has the molecular formula C11H11F4NO3 and a molecular weight of 281.21 g/mol. Its IUPAC name is methyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate.
| Compound Name | methyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 150641345 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | methyl N-methoxy-N-[2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]carbamate |
| SMILES | COC(=O)N(OC)C(c1ccc(F)cc1)C(F)(F)F |
| InChI | InChI=1S/C11H11F4NO3/c1-18-10(17)16(19-2)9(11(13,14)15)7-3-5-8(12)6-4-7/h3-6,9H,1-2H3 |
| InChIKey | IZZADNUDBCXODI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|