C30H44O5S2 — CID 15064509
benzyl 5-[8-(4-methylphenyl)sulfonyloxyundecylsulfanyl]pentanoate (PubChem CID 15064509) has the molecular formula C30H44O5S2 and a molecular weight of 548.81 g/mol. Its IUPAC name is benzyl 5-[8-(4-methylphenyl)sulfonyloxyundecylsulfanyl]pentanoate.
| Compound Name | benzyl 5-[8-(4-methylphenyl)sulfonyloxyundecylsulfanyl]pentanoate |
|---|---|
| PubChem CID | 15064509 |
| Molecular Formula | C30H44O5S2 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.26 |
| IUPAC Name | benzyl 5-[8-(4-methylphenyl)sulfonyloxyundecylsulfanyl]pentanoate |
| SMILES | CCCC(CCCCCCCSCCCCC(=O)OCc1ccccc1)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H44O5S2/c1-3-14-28(35-37(32,33)29-21-19-26(2)20-22-29)17-10-5-4-6-12-23-36-24-13-11-18-30(31)34-25-27-15-8-7-9-16-27/h7-9,15-16,19-22,28H,3-6,10-14,17-18,23-25H2,1-2H3 |
| InChIKey | GEMILMKCNKPVLW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|