C11H21N2+ — CID 150648797
2,3,4-triethyl-1-methyl-2H-pyrimidin-1-ium (PubChem CID 150648797) has the molecular formula C11H21N2+ and a molecular weight of 181.30 g/mol. Its IUPAC name is 2,3,4-triethyl-1-methyl-2H-pyrimidin-1-ium.
| Compound Name | 2,3,4-triethyl-1-methyl-2H-pyrimidin-1-ium |
|---|---|
| PubChem CID | 150648797 |
| Molecular Formula | C11H21N2+ |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.17 |
| IUPAC Name | 2,3,4-triethyl-1-methyl-2H-pyrimidin-1-ium |
| SMILES | CCC1=CC=[N+](C)C(CC)N1CC |
| InChI | InChI=1S/C11H21N2/c1-5-10-8-9-12(4)11(6-2)13(10)7-3/h8-9,11H,5-7H2,1-4H3/q+1 |
| InChIKey | JBKVXKWUEDBNTR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|