C20H21N3O5 — CID 150653489
2-[3-[3-(2-amino-4-ethoxycarbonylanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid (PubChem CID 150653489) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[3-[3-(2-amino-4-ethoxycarbonylanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid.
| Compound Name | 2-[3-[3-(2-amino-4-ethoxycarbonylanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 150653489 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[3-[3-(2-amino-4-ethoxycarbonylanilino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetic acid |
| SMILES | CCOC(=O)c1ccc(Nc2cccc(C3=NOC(CC(=O)O)C3)c2)c(N)c1 |
| InChI | InChI=1S/C20H21N3O5/c1-2-27-20(26)13-6-7-17(16(21)9-13)22-14-5-3-4-12(8-14)18-10-15(28-23-18)11-19(24)25/h3-9,15,22H,2,10-11,21H2,1H3,(H,24,25) |
| InChIKey | JCJJXXRSIMJUMQ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|