C7H11F2N3 — CID 150655987
2-(2,2-difluoroethyl)-1H-pyridine-2,5-diamine (PubChem CID 150655987) has the molecular formula C7H11F2N3 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1H-pyridine-2,5-diamine.
| Compound Name | 2-(2,2-difluoroethyl)-1H-pyridine-2,5-diamine |
|---|---|
| PubChem CID | 150655987 |
| Molecular Formula | C7H11F2N3 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 2-(2,2-difluoroethyl)-1H-pyridine-2,5-diamine |
| SMILES | NC1=CNC(N)(CC(F)F)C=C1 |
| InChI | InChI=1S/C7H11F2N3/c8-6(9)3-7(11)2-1-5(10)4-12-7/h1-2,4,6,12H,3,10-11H2 |
| InChIKey | JCWBFKVHTCULRU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |