C22H26F3N5O — CID 150656300
2-[carbamimidoyl(2-cyclopropylethyl)amino]-6-methyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-4-carboxamide (PubChem CID 150656300) has the molecular formula C22H26F3N5O and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-[carbamimidoyl(2-cyclopropylethyl)amino]-6-methyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-4-carboxamide.
| Compound Name | 2-[carbamimidoyl(2-cyclopropylethyl)amino]-6-methyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 150656300 |
| Molecular Formula | C22H26F3N5O |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-[carbamimidoyl(2-cyclopropylethyl)amino]-6-methyl-N-[(1R)-1-[3-(trifluoromethyl)phenyl]ethyl]pyridine-4-carboxamide |
| SMILES | [H]/N=C(\N)N(CCC1CC1)c1cc(C(=O)N[C@H](C)c2cccc(C(F)(F)F)c2)cc(C)n1 |
| InChI | InChI=1S/C22H26F3N5O/c1-13-10-17(12-19(28-13)30(21(26)27)9-8-15-6-7-15)20(31)29-14(2)16-4-3-5-18(11-16)22(23,24)25/h3-5,10-12,14-15H,6-9H2,1-2H3,(H3,26,27)(H,29,31)/t14-/m1/s1 |
| InChIKey | JCXPIRNODQEKTR-CQSZACIVSA-N |
| XLogP | 4.40 |
| TPSA | 95.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|