C25H48O3 — CID 150660055
1-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclohexene (PubChem CID 150660055) has the molecular formula C25H48O3 and a molecular weight of 396.66 g/mol. Its IUPAC name is 1-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclohexene.
| Compound Name | 1-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclohexene |
|---|---|
| PubChem CID | 150660055 |
| Molecular Formula | C25H48O3 |
| Molecular Weight | 396.66 g/mol |
| Exact Mass | 396.36 |
| IUPAC Name | 1-[1,1,1-tri(propan-2-yloxy)decan-2-yl]cyclohexene |
| SMILES | CCCCCCCCC(C1=CCCCC1)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C25H48O3/c1-8-9-10-11-12-16-19-24(23-17-14-13-15-18-23)25(26-20(2)3,27-21(4)5)28-22(6)7/h17,20-22,24H,8-16,18-19H2,1-7H3 |
| InChIKey | JDRXSHNWPVFMRF-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.66 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|