C29H33NO11 — CID 150669105
(2S,3S,4R,5R,6S)-N-cyclobutyl-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxyoxane-2-carboxamide (PubChem CID 150669105) has the molecular formula C29H33NO11 and a molecular weight of 571.58 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-N-cyclobutyl-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxyoxane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R,6S)-N-cyclobutyl-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxyoxane-2-carboxamide |
|---|---|
| PubChem CID | 150669105 |
| Molecular Formula | C29H33NO11 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | (2S,3S,4R,5R,6S)-N-cyclobutyl-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxyoxane-2-carboxamide |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c([C@@H]4O[C@H](C(=O)NC5CCC5)[C@@H](O)[C@H](O)[C@H]4O)c(OC)cc3o2)cc1OC |
| InChI | InChI=1S/C29H33NO11/c1-36-16-9-8-13(10-18(16)37-2)17-11-15(31)21-20(40-17)12-19(38-3)22(26(21)39-4)27-24(33)23(32)25(34)28(41-27)29(35)30-14-6-5-7-14/h8-12,14,23-25,27-28,32-34H,5-7H2,1-4H3,(H,30,35)/t23-,24-,25+,27+,28+/m1/s1 |
| InChIKey | JFMVVUWQKXCPJQ-XWODRAHCSA-N |
| XLogP | 1.69 |
| TPSA | 166.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |