C28H28N2O11S — CID 155210428
(2S,3S,4R,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(1,3-thiazol-2-yl)oxane-2-carboxamide (PubChem CID 155210428) has the molecular formula C28H28N2O11S and a molecular weight of 600.60 g/mol. Its IUPAC name is (2S,3S,4R,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(1,3-thiazol-2-yl)oxane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(1,3-thiazol-2-yl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 155210428 |
| Molecular Formula | C28H28N2O11S |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | (2S,3S,4R,5R,6S)-6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(1,3-thiazol-2-yl)oxane-2-carboxamide |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c([C@@H]4O[C@H](C(=O)Nc5nccs5)[C@@H](O)[C@H](O)[C@H]4O)c(OC)cc3o2)cc1OC |
| InChI | InChI=1S/C28H28N2O11S/c1-36-14-6-5-12(9-16(14)37-2)15-10-13(31)19-18(40-15)11-17(38-3)20(24(19)39-4)25-22(33)21(32)23(34)26(41-25)27(35)30-28-29-7-8-42-28/h5-11,21-23,25-26,32-34H,1-4H3,(H,29,30,35)/t21-,22-,23+,25+,26+/m1/s1 |
| InChIKey | OPTBYAUXWUTCLH-RPWISQQKSA-N |
| XLogP | 2.11 |
| TPSA | 179.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |