C28H30F3NO11 — CID 155224941
6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide (PubChem CID 155224941) has the molecular formula C28H30F3NO11 and a molecular weight of 613.54 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide.
| Compound Name | 6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 155224941 |
| Molecular Formula | C28H30F3NO11 |
| Molecular Weight | 613.54 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 6-[2-(3,4-dimethoxyphenyl)-5,7-dimethoxy-4-oxochromen-6-yl]-3,4,5-trihydroxy-N-(3,3,3-trifluoropropyl)oxane-2-carboxamide |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(C4OC(C(=O)NCCC(F)(F)F)C(O)C(O)C4O)c(OC)cc3o2)cc1OC |
| InChI | InChI=1S/C28H30F3NO11/c1-38-14-6-5-12(9-16(14)39-2)15-10-13(33)19-18(42-15)11-17(40-3)20(24(19)41-4)25-22(35)21(34)23(36)26(43-25)27(37)32-8-7-28(29,30)31/h5-6,9-11,21-23,25-26,34-36H,7-8H2,1-4H3,(H,32,37) |
| InChIKey | DMNDWSIVGOFKHX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 166.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |