C22H23FN2O2 — CID 150673935
1-[[4-fluoro-2,3-bis(phenylmethoxy)phenyl]methyl]-1-methylhydrazine (PubChem CID 150673935) has the molecular formula C22H23FN2O2 and a molecular weight of 366.44 g/mol. Its IUPAC name is 1-[[4-fluoro-2,3-bis(phenylmethoxy)phenyl]methyl]-1-methylhydrazine.
| Compound Name | 1-[[4-fluoro-2,3-bis(phenylmethoxy)phenyl]methyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 150673935 |
| Molecular Formula | C22H23FN2O2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[[4-fluoro-2,3-bis(phenylmethoxy)phenyl]methyl]-1-methylhydrazine |
| SMILES | CN(N)Cc1ccc(F)c(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H23FN2O2/c1-25(24)14-19-12-13-20(23)22(27-16-18-10-6-3-7-11-18)21(19)26-15-17-8-4-2-5-9-17/h2-13H,14-16,24H2,1H3 |
| InChIKey | JGLSECYXLVQDRQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|