C21H26FNO — CID 123524906
ethane;5-fluoro-1-methyl-4-phenylmethoxy-3-propylindole (PubChem CID 123524906) has the molecular formula C21H26FNO and a molecular weight of 327.44 g/mol. Its IUPAC name is ethane;5-fluoro-1-methyl-4-phenylmethoxy-3-propylindole.
| Compound Name | ethane;5-fluoro-1-methyl-4-phenylmethoxy-3-propylindole |
|---|---|
| PubChem CID | 123524906 |
| Molecular Formula | C21H26FNO |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | ethane;5-fluoro-1-methyl-4-phenylmethoxy-3-propylindole |
| SMILES | CC.CCCc1cn(C)c2ccc(F)c(OCc3ccccc3)c12 |
| InChI | InChI=1S/C19H20FNO.C2H6/c1-3-7-15-12-21(2)17-11-10-16(20)19(18(15)17)22-13-14-8-5-4-6-9-14;1-2/h4-6,8-12H,3,7,13H2,1-2H3;1-2H3 |
| InChIKey | NCOOJFQKMPOXNP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |