C21H25FN2O3 — CID 58303903
N-[(3,4-dimethoxyphenyl)methyl]-2-(5-fluoro-4-methoxy-1-methylindol-3-yl)ethanamine (PubChem CID 58303903) has the molecular formula C21H25FN2O3 and a molecular weight of 372.44 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-2-(5-fluoro-4-methoxy-1-methylindol-3-yl)ethanamine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(5-fluoro-4-methoxy-1-methylindol-3-yl)ethanamine |
|---|---|
| PubChem CID | 58303903 |
| Molecular Formula | C21H25FN2O3 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-2-(5-fluoro-4-methoxy-1-methylindol-3-yl)ethanamine |
| SMILES | COc1ccc(CNCCc2cn(C)c3ccc(F)c(OC)c23)cc1OC |
| InChI | InChI=1S/C21H25FN2O3/c1-24-13-15(20-17(24)7-6-16(22)21(20)27-4)9-10-23-12-14-5-8-18(25-2)19(11-14)26-3/h5-8,11,13,23H,9-10,12H2,1-4H3 |
| InChIKey | HVYSKHDQVPMEKF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|