C24H30FN3O — CID 58303868
5-fluoro-4-methoxy-1-methyl-3-[3-[3-(4-methylpiperazin-1-yl)phenyl]propyl]indole (PubChem CID 58303868) has the molecular formula C24H30FN3O and a molecular weight of 395.52 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-1-methyl-3-[3-[3-(4-methylpiperazin-1-yl)phenyl]propyl]indole.
| Compound Name | 5-fluoro-4-methoxy-1-methyl-3-[3-[3-(4-methylpiperazin-1-yl)phenyl]propyl]indole |
|---|---|
| PubChem CID | 58303868 |
| Molecular Formula | C24H30FN3O |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 5-fluoro-4-methoxy-1-methyl-3-[3-[3-(4-methylpiperazin-1-yl)phenyl]propyl]indole |
| SMILES | COc1c(F)ccc2c1c(CCCc1cccc(N3CCN(C)CC3)c1)cn2C |
| InChI | InChI=1S/C24H30FN3O/c1-26-12-14-28(15-13-26)20-9-5-7-18(16-20)6-4-8-19-17-27(2)22-11-10-21(25)24(29-3)23(19)22/h5,7,9-11,16-17H,4,6,8,12-15H2,1-3H3 |
| InChIKey | OWXYDAYURRGTIH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |