C26H33N3O3 — CID 154863719
2-[4-[[2-(1,6-dimethylindol-3-yl)ethylamino]methyl]-2-methoxyphenoxy]-1-pyrrolidin-1-ylethanone (PubChem CID 154863719) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 2-[4-[[2-(1,6-dimethylindol-3-yl)ethylamino]methyl]-2-methoxyphenoxy]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[4-[[2-(1,6-dimethylindol-3-yl)ethylamino]methyl]-2-methoxyphenoxy]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 154863719 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 2-[4-[[2-(1,6-dimethylindol-3-yl)ethylamino]methyl]-2-methoxyphenoxy]-1-pyrrolidin-1-ylethanone |
| SMILES | COc1cc(CNCCc2cn(C)c3cc(C)ccc23)ccc1OCC(=O)N1CCCC1 |
| InChI | InChI=1S/C26H33N3O3/c1-19-6-8-22-21(17-28(2)23(22)14-19)10-11-27-16-20-7-9-24(25(15-20)31-3)32-18-26(30)29-12-4-5-13-29/h6-9,14-15,17,27H,4-5,10-13,16,18H2,1-3H3 |
| InChIKey | NKXPPTMZZAPMJU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|