C19H40O6P2 — CID 15067933
1,1-bis[di(propan-2-yloxy)phosphoryl]cycloheptane (PubChem CID 15067933) has the molecular formula C19H40O6P2 and a molecular weight of 426.47 g/mol. Its IUPAC name is 1,1-bis[di(propan-2-yloxy)phosphoryl]cycloheptane.
| Compound Name | 1,1-bis[di(propan-2-yloxy)phosphoryl]cycloheptane |
|---|---|
| PubChem CID | 15067933 |
| Molecular Formula | C19H40O6P2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1,1-bis[di(propan-2-yloxy)phosphoryl]cycloheptane |
| SMILES | CC(C)OP(=O)(OC(C)C)C1(P(=O)(OC(C)C)OC(C)C)CCCCCC1 |
| InChI | InChI=1S/C19H40O6P2/c1-15(2)22-26(20,23-16(3)4)19(13-11-9-10-12-14-19)27(21,24-17(5)6)25-18(7)8/h15-18H,9-14H2,1-8H3 |
| InChIKey | DVJAEZPOWXHFOL-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|