C12H22ClO5P — CID 11823126
cis-methyl (1S,2R)-2-chloro-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropane-1-carboxylate (PubChem CID 11823126) has the molecular formula C12H22ClO5P and a molecular weight of 312.73 g/mol. Its IUPAC name is cis-methyl (1S,2R)-2-chloro-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-2-chloro-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11823126 |
| Molecular Formula | C12H22ClO5P |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | cis-methyl (1S,2R)-2-chloro-2-di(propan-2-yloxy)phosphoryl-1-methylcyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)C[C@]1(Cl)P(=O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C12H22ClO5P/c1-8(2)17-19(15,18-9(3)4)12(13)7-11(12,5)10(14)16-6/h8-9H,7H2,1-6H3/t11-,12-/m0/s1 |
| InChIKey | VJENLMLWYBEHGN-RYUDHWBXSA-N |
| XLogP | 3.55 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|