C25H41NO2 — CID 15069705
(2E,6E,10E,14E)-N-ethyl-2,6,10,14-tetramethyl-18-oxononadeca-2,6,10,14-tetraenamide (PubChem CID 15069705) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is (2E,6E,10E,14E)-N-ethyl-2,6,10,14-tetramethyl-18-oxononadeca-2,6,10,14-tetraenamide.
| Compound Name | (2E,6E,10E,14E)-N-ethyl-2,6,10,14-tetramethyl-18-oxononadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 15069705 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | (2E,6E,10E,14E)-N-ethyl-2,6,10,14-tetramethyl-18-oxononadeca-2,6,10,14-tetraenamide |
| SMILES | CCNC(=O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C25H41NO2/c1-7-26-25(28)23(5)18-10-16-21(3)14-8-12-20(2)13-9-15-22(4)17-11-19-24(6)27/h13-14,17-18H,7-12,15-16,19H2,1-6H3,(H,26,28)/b20-13+,21-14+,22-17+,23-18+ |
| InChIKey | BKMIEMFBICXTJT-SLPFTHLESA-N |
| XLogP | 6.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|