C24H41NO2 — CID 15069715
(2E,6E,10E)-2,6,10-trimethyl-14-oxo-N,N-dipropylpentadeca-2,6,10-trienamide (PubChem CID 15069715) has the molecular formula C24H41NO2 and a molecular weight of 375.60 g/mol. Its IUPAC name is (2E,6E,10E)-2,6,10-trimethyl-14-oxo-N,N-dipropylpentadeca-2,6,10-trienamide.
| Compound Name | (2E,6E,10E)-2,6,10-trimethyl-14-oxo-N,N-dipropylpentadeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 15069715 |
| Molecular Formula | C24H41NO2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 375.31 |
| IUPAC Name | (2E,6E,10E)-2,6,10-trimethyl-14-oxo-N,N-dipropylpentadeca-2,6,10-trienamide |
| SMILES | CCCN(CCC)C(=O)/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C24H41NO2/c1-7-18-25(19-8-2)24(27)22(5)16-10-14-20(3)12-9-13-21(4)15-11-17-23(6)26/h12,15-16H,7-11,13-14,17-19H2,1-6H3/b20-12+,21-15+,22-16+ |
| InChIKey | RCYQHCUOCYGMTB-JTGSTRJLSA-N |
| XLogP | 6.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|