C14H26N2O2 — CID 5374867
(Z)-N,N,N',N',2-pentaethylbut-2-enediamide (PubChem CID 5374867) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (Z)-N,N,N',N',2-pentaethylbut-2-enediamide.
| Compound Name | (Z)-N,N,N',N',2-pentaethylbut-2-enediamide |
|---|---|
| PubChem CID | 5374867 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (Z)-N,N,N',N',2-pentaethylbut-2-enediamide |
| SMILES | CC/C(=C/C(=O)N(CC)CC)C(=O)N(CC)CC |
| InChI | InChI=1S/C14H26N2O2/c1-6-12(14(18)16(9-4)10-5)11-13(17)15(7-2)8-3/h11H,6-10H2,1-5H3/b12-11- |
| InChIKey | FUBDFJMOSRYDMT-QXMHVHEDSA-N |
| XLogP | 2.06 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|