C14H23NO3 — CID 11230533
(E)-N,N,5-triethyl-3,6-dioxooct-4-enamide (PubChem CID 11230533) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is (E)-N,N,5-triethyl-3,6-dioxooct-4-enamide.
| Compound Name | (E)-N,N,5-triethyl-3,6-dioxooct-4-enamide |
|---|---|
| PubChem CID | 11230533 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | (E)-N,N,5-triethyl-3,6-dioxooct-4-enamide |
| SMILES | CCC(=O)/C(=C/C(=O)CC(=O)N(CC)CC)CC |
| InChI | InChI=1S/C14H23NO3/c1-5-11(13(17)6-2)9-12(16)10-14(18)15(7-3)8-4/h9H,5-8,10H2,1-4H3/b11-9+ |
| InChIKey | BWCONWUWXMCXBC-PKNBQFBNSA-N |
| XLogP | 2.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|