C12H19NO2 — CID 5366303
(4E,6E)-N,N-diethyl-3-oxoocta-4,6-dienamide (PubChem CID 5366303) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (4E,6E)-N,N-diethyl-3-oxoocta-4,6-dienamide.
| Compound Name | (4E,6E)-N,N-diethyl-3-oxoocta-4,6-dienamide |
|---|---|
| PubChem CID | 5366303 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (4E,6E)-N,N-diethyl-3-oxoocta-4,6-dienamide |
| SMILES | C/C=C/C=C/C(=O)CC(=O)N(CC)CC |
| InChI | InChI=1S/C12H19NO2/c1-4-7-8-9-11(14)10-12(15)13(5-2)6-3/h4,7-9H,5-6,10H2,1-3H3/b7-4+,9-8+ |
| InChIKey | PLXIRHLVYIXPNT-NUXDXBQRSA-N |
| XLogP | 1.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|