C26H27N3O3S — CID 150734821
ethyl 4-[4-[3-(1-benzothiophen-3-yl)-3-oxopropyl]piperazin-1-yl]-1H-indole-2-carboxylate (PubChem CID 150734821) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is ethyl 4-[4-[3-(1-benzothiophen-3-yl)-3-oxopropyl]piperazin-1-yl]-1H-indole-2-carboxylate.
| Compound Name | ethyl 4-[4-[3-(1-benzothiophen-3-yl)-3-oxopropyl]piperazin-1-yl]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 150734821 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | ethyl 4-[4-[3-(1-benzothiophen-3-yl)-3-oxopropyl]piperazin-1-yl]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(N3CCN(CCC(=O)c4csc5ccccc45)CC3)cccc2[nH]1 |
| InChI | InChI=1S/C26H27N3O3S/c1-2-32-26(31)22-16-19-21(27-22)7-5-8-23(19)29-14-12-28(13-15-29)11-10-24(30)20-17-33-25-9-4-3-6-18(20)25/h3-9,16-17,27H,2,10-15H2,1H3 |
| InChIKey | JSPLFTRISNRDLW-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |