C22H20F3N3O3S — CID 71591300
1-(1-benzothiophen-3-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 71591300) has the molecular formula C22H20F3N3O3S and a molecular weight of 463.48 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 71591300 |
| Molecular Formula | C22H20F3N3O3S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-[4-[4-nitro-2-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CCN(c2ccc([N+](=O)[O-])cc2C(F)(F)F)CC1)c1csc2ccccc12 |
| InChI | InChI=1S/C22H20F3N3O3S/c23-22(24,25)18-13-15(28(30)31)5-6-19(18)27-11-9-26(10-12-27)8-7-20(29)17-14-32-21-4-2-1-3-16(17)21/h1-6,13-14H,7-12H2 |
| InChIKey | RXGRNGFVHHWCPK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|