C21H17N3O — CID 15073525
1-benzyl-2-(4-methylphenyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 15073525) has the molecular formula C21H17N3O and a molecular weight of 327.39 g/mol. Its IUPAC name is 1-benzyl-2-(4-methylphenyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 1-benzyl-2-(4-methylphenyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 15073525 |
| Molecular Formula | C21H17N3O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-benzyl-2-(4-methylphenyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | Cc1ccc(-c2nc(=O)c3cccnc3n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17N3O/c1-15-9-11-17(12-10-15)19-23-21(25)18-8-5-13-22-20(18)24(19)14-16-6-3-2-4-7-16/h2-13H,14H2,1H3 |
| InChIKey | HZHGHMFIIMLMBN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |