C5H8O2S — CID 15073789
6-methyl-2,3-dihydro-1,4-oxathiine 4-oxide (PubChem CID 15073789) has the molecular formula C5H8O2S and a molecular weight of 132.18 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1,4-oxathiine 4-oxide.
| Compound Name | 6-methyl-2,3-dihydro-1,4-oxathiine 4-oxide |
|---|---|
| PubChem CID | 15073789 |
| Molecular Formula | C5H8O2S |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.02 |
| IUPAC Name | 6-methyl-2,3-dihydro-1,4-oxathiine 4-oxide |
| SMILES | CC1=CS(=O)CCO1 |
| InChI | InChI=1S/C5H8O2S/c1-5-4-8(6)3-2-7-5/h4H,2-3H2,1H3 |
| InChIKey | PNXOSYVTGBMNCM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |