C23H26O4 — CID 150740302
2-[1-(4-ethenylphenyl)-2,2-dimethyl-3-phenylpropyl]-2-methylpropanedioic acid (PubChem CID 150740302) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-[1-(4-ethenylphenyl)-2,2-dimethyl-3-phenylpropyl]-2-methylpropanedioic acid.
| Compound Name | 2-[1-(4-ethenylphenyl)-2,2-dimethyl-3-phenylpropyl]-2-methylpropanedioic acid |
|---|---|
| PubChem CID | 150740302 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 2-[1-(4-ethenylphenyl)-2,2-dimethyl-3-phenylpropyl]-2-methylpropanedioic acid |
| SMILES | C=Cc1ccc(C(C(C)(C)Cc2ccccc2)C(C)(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H26O4/c1-5-16-11-13-18(14-12-16)19(23(4,20(24)25)21(26)27)22(2,3)15-17-9-7-6-8-10-17/h5-14,19H,1,15H2,2-4H3,(H,24,25)(H,26,27) |
| InChIKey | JTSBNXVMHONIOO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|