C11H11N3 — CID 15076037
4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile (PubChem CID 15076037) has the molecular formula C11H11N3 and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile.
| Compound Name | 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 15076037 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile |
| SMILES | N#CC1=C(N)CN(c2ccccc2)C1 |
| InChI | InChI=1S/C11H11N3/c12-6-9-7-14(8-11(9)13)10-4-2-1-3-5-10/h1-5H,7-8,13H2 |
| InChIKey | ZVBFMKPWNRYFPK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |