About 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile
4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile (PubChem CID 15076037) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile.
Molecular Properties
| Compound Name | 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile |
| PubChem CID | 15076037 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile |
| SMILES | N#CC1=C(N)CN(c2ccccc2)C1 |
| InChI | InChI=1S/C11H11N3/c12-6-9-7-14(8-11(9)13)10-4-2-1-3-5-10/h1-5H,7-8,13H2 |
| InChIKey | ZVBFMKPWNRYFPK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile?
The IUPAC name of 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile (CID 15076037) is 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile.
What is the SMILES notation for 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile?
The canonical SMILES for 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile is N#CC1=C(N)CN(c2ccccc2)C1.
What is the InChIKey of 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile?
The InChIKey is ZVBFMKPWNRYFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c12-6-9-7-14(8-11(9)13)10-4-2-1-3-5-10/h1-5H,7-8,13H2.
What are the key properties of 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile?
4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile has a molecular weight of 185.23 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-phenyl-2,5-dihydropyrrole-3-carbonitrile is sourced from PubChem (CID 15076037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).