C12H13N3 — CID 177312185
4-amino-1-benzyl-2,5-dihydropyrrole-3-carbonitrile (PubChem CID 177312185) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-amino-1-benzyl-2,5-dihydropyrrole-3-carbonitrile.
| Compound Name | 4-amino-1-benzyl-2,5-dihydropyrrole-3-carbonitrile |
|---|---|
| PubChem CID | 177312185 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-amino-1-benzyl-2,5-dihydropyrrole-3-carbonitrile |
| SMILES | N#CC1=C(N)CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H13N3/c13-6-11-8-15(9-12(11)14)7-10-4-2-1-3-5-10/h1-5H,7-9,14H2 |
| InChIKey | YBWPQFBCOKQEFA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |