C15H13FN4O2 — CID 150773102
amino 2-[4-(aminomethyl)phenyl]-5-fluoroindazole-7-carboxylate (PubChem CID 150773102) has the molecular formula C15H13FN4O2 and a molecular weight of 300.29 g/mol. Its IUPAC name is amino 2-[4-(aminomethyl)phenyl]-5-fluoroindazole-7-carboxylate.
| Compound Name | amino 2-[4-(aminomethyl)phenyl]-5-fluoroindazole-7-carboxylate |
|---|---|
| PubChem CID | 150773102 |
| Molecular Formula | C15H13FN4O2 |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | amino 2-[4-(aminomethyl)phenyl]-5-fluoroindazole-7-carboxylate |
| SMILES | NCc1ccc(-n2cc3cc(F)cc(C(=O)ON)c3n2)cc1 |
| InChI | InChI=1S/C15H13FN4O2/c16-11-5-10-8-20(12-3-1-9(7-17)2-4-12)19-14(10)13(6-11)15(21)22-18/h1-6,8H,7,17-18H2 |
| InChIKey | KAHAJJSSTVXYGJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|