C20H17ClF2N4O4 — CID 175155415
5-[4-(7-carbamoyl-5-fluoroindazol-2-yl)anilino]-4-(chloromethyl)-2-fluoro-5-oxopentanoic acid (PubChem CID 175155415) has the molecular formula C20H17ClF2N4O4 and a molecular weight of 450.83 g/mol. Its IUPAC name is 5-[4-(7-carbamoyl-5-fluoroindazol-2-yl)anilino]-4-(chloromethyl)-2-fluoro-5-oxopentanoic acid.
| Compound Name | 5-[4-(7-carbamoyl-5-fluoroindazol-2-yl)anilino]-4-(chloromethyl)-2-fluoro-5-oxopentanoic acid |
|---|---|
| PubChem CID | 175155415 |
| Molecular Formula | C20H17ClF2N4O4 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 5-[4-(7-carbamoyl-5-fluoroindazol-2-yl)anilino]-4-(chloromethyl)-2-fluoro-5-oxopentanoic acid |
| SMILES | NC(=O)c1cc(F)cc2cn(-c3ccc(NC(=O)C(CCl)CC(F)C(=O)O)cc3)nc12 |
| InChI | InChI=1S/C20H17ClF2N4O4/c21-8-10(6-16(23)20(30)31)19(29)25-13-1-3-14(4-2-13)27-9-11-5-12(22)7-15(18(24)28)17(11)26-27/h1-5,7,9-10,16H,6,8H2,(H2,24,28)(H,25,29)(H,30,31) |
| InChIKey | NITRZLVSNQHPAI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|