C25H50O3 — CID 150775329
4-(3-but-1-enoxypropyl)-3,3-dipropoxydodecane (PubChem CID 150775329) has the molecular formula C25H50O3 and a molecular weight of 398.67 g/mol. Its IUPAC name is 4-(3-but-1-enoxypropyl)-3,3-dipropoxydodecane.
| Compound Name | 4-(3-but-1-enoxypropyl)-3,3-dipropoxydodecane |
|---|---|
| PubChem CID | 150775329 |
| Molecular Formula | C25H50O3 |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 398.38 |
| IUPAC Name | 4-(3-but-1-enoxypropyl)-3,3-dipropoxydodecane |
| SMILES | CCC=COCCCC(CCCCCCCC)C(CC)(OCCC)OCCC |
| InChI | InChI=1S/C25H50O3/c1-6-11-13-14-15-16-18-24(19-17-23-26-22-12-7-2)25(10-5,27-20-8-3)28-21-9-4/h12,22,24H,6-11,13-21,23H2,1-5H3 |
| InChIKey | KATAXPXZXIAKNJ-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|