C22H42O2 — CID 141426026
2,2-dimethyl-4-(5,9,13-trimethyltetradecyl)-1,3-dioxole (PubChem CID 141426026) has the molecular formula C22H42O2 and a molecular weight of 338.58 g/mol. Its IUPAC name is 2,2-dimethyl-4-(5,9,13-trimethyltetradecyl)-1,3-dioxole.
| Compound Name | 2,2-dimethyl-4-(5,9,13-trimethyltetradecyl)-1,3-dioxole |
|---|---|
| PubChem CID | 141426026 |
| Molecular Formula | C22H42O2 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.32 |
| IUPAC Name | 2,2-dimethyl-4-(5,9,13-trimethyltetradecyl)-1,3-dioxole |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCCC1=COC(C)(C)O1 |
| InChI | InChI=1S/C22H42O2/c1-18(2)11-9-13-20(4)15-10-14-19(3)12-7-8-16-21-17-23-22(5,6)24-21/h17-20H,7-16H2,1-6H3 |
| InChIKey | RQMPBUPQMBCFIP-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|