C13H24O2 — CID 141403794
2-[(2R)-2,6-dimethylheptyl]-4-methyl-1,3-dioxole (PubChem CID 141403794) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-[(2R)-2,6-dimethylheptyl]-4-methyl-1,3-dioxole.
| Compound Name | 2-[(2R)-2,6-dimethylheptyl]-4-methyl-1,3-dioxole |
|---|---|
| PubChem CID | 141403794 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-[(2R)-2,6-dimethylheptyl]-4-methyl-1,3-dioxole |
| SMILES | CC1=COC(C[C@H](C)CCCC(C)C)O1 |
| InChI | InChI=1S/C13H24O2/c1-10(2)6-5-7-11(3)8-13-14-9-12(4)15-13/h9-11,13H,5-8H2,1-4H3/t11-,13?/m1/s1 |
| InChIKey | MTXWJZKPAKKZCZ-JTDNENJMSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |