C27H54O3 — CID 150782391
4-(3-but-1-enoxypropyl)-3,3-dibutoxydodecane (PubChem CID 150782391) has the molecular formula C27H54O3 and a molecular weight of 426.73 g/mol. Its IUPAC name is 4-(3-but-1-enoxypropyl)-3,3-dibutoxydodecane.
| Compound Name | 4-(3-but-1-enoxypropyl)-3,3-dibutoxydodecane |
|---|---|
| PubChem CID | 150782391 |
| Molecular Formula | C27H54O3 |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.41 |
| IUPAC Name | 4-(3-but-1-enoxypropyl)-3,3-dibutoxydodecane |
| SMILES | CCC=COCCCC(CCCCCCCC)C(CC)(OCCCC)OCCCC |
| InChI | InChI=1S/C27H54O3/c1-6-11-15-16-17-18-20-26(21-19-23-28-22-12-7-2)27(10-5,29-24-13-8-3)30-25-14-9-4/h12,22,26H,6-11,13-21,23-25H2,1-5H3 |
| InChIKey | KCDTUMNSKDMMCI-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|