C13H17F2N3O5 — CID 150782904
[1-amino-3-[4-(difluoromethoxy)phenyl]-1-(2-hydroxyethoxyimino)propan-2-yl]carbamic acid (PubChem CID 150782904) has the molecular formula C13H17F2N3O5 and a molecular weight of 333.29 g/mol. Its IUPAC name is [1-amino-3-[4-(difluoromethoxy)phenyl]-1-(2-hydroxyethoxyimino)propan-2-yl]carbamic acid.
| Compound Name | [1-amino-3-[4-(difluoromethoxy)phenyl]-1-(2-hydroxyethoxyimino)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 150782904 |
| Molecular Formula | C13H17F2N3O5 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | [1-amino-3-[4-(difluoromethoxy)phenyl]-1-(2-hydroxyethoxyimino)propan-2-yl]carbamic acid |
| SMILES | NC(=NOCCO)C(Cc1ccc(OC(F)F)cc1)NC(=O)O |
| InChI | InChI=1S/C13H17F2N3O5/c14-12(15)23-9-3-1-8(2-4-9)7-10(17-13(20)21)11(16)18-22-6-5-19/h1-4,10,12,17,19H,5-7H2,(H2,16,18)(H,20,21) |
| InChIKey | KCGHHQJSLZWGGW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|