C9H18O6S — CID 150805832
(2R)-2-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1-sulfonic acid (PubChem CID 150805832) has the molecular formula C9H18O6S and a molecular weight of 254.30 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1-sulfonic acid.
| Compound Name | (2R)-2-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 150805832 |
| Molecular Formula | C9H18O6S |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (2R)-2-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1-sulfonic acid |
| SMILES | C[C@@H](CS(=O)(=O)O)[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C9H18O6S/c1-6(5-16(11,12)13)8-7(4-10)14-9(2,3)15-8/h6-8,10H,4-5H2,1-3H3,(H,11,12,13)/t6-,7-,8-/m0/s1 |
| InChIKey | KGVOVWBJHJXEED-FXQIFTODSA-N |
| XLogP | 0.02 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|