C20H28O3 — CID 15081415
8-(5-hept-6-enyl-2,2-dimethyl-1,3-dioxolan-4-yl)oct-1-en-4,6-diyn-3-ol (PubChem CID 15081415) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 8-(5-hept-6-enyl-2,2-dimethyl-1,3-dioxolan-4-yl)oct-1-en-4,6-diyn-3-ol.
| Compound Name | 8-(5-hept-6-enyl-2,2-dimethyl-1,3-dioxolan-4-yl)oct-1-en-4,6-diyn-3-ol |
|---|---|
| PubChem CID | 15081415 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 8-(5-hept-6-enyl-2,2-dimethyl-1,3-dioxolan-4-yl)oct-1-en-4,6-diyn-3-ol |
| SMILES | C=CCCCCCC1OC(C)(C)OC1CC#CC#CC(O)C=C |
| InChI | InChI=1S/C20H28O3/c1-5-7-8-9-12-15-18-19(23-20(3,4)22-18)16-13-10-11-14-17(21)6-2/h5-6,17-19,21H,1-2,7-9,12,15-16H2,3-4H3 |
| InChIKey | GVKARGKQHKVPBI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|